
CAS 213318-44-6
:1-Boc-indole-2-boronic acid
Description:
1-Boc-indole-2-boronic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The "Boc" (tert-butyloxycarbonyl) group serves as a protecting group for the amine functionality, enhancing the compound's stability and reactivity in various chemical reactions. The presence of the boronic acid functional group (-B(OH)2) is significant for its ability to participate in Suzuki coupling reactions, making it valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. This compound is typically used in medicinal chemistry and material science due to its potential applications in drug development and the synthesis of complex organic molecules. Additionally, 1-Boc-indole-2-boronic acid is soluble in organic solvents, which facilitates its use in various synthetic protocols. Its reactivity and functional groups make it a versatile intermediate in the synthesis of more complex indole derivatives.
Formula:C13H16BNO4
InChI:InChI=1/C13H16BNO4/c1-13(2,3)19-12(16)15-10-7-5-4-6-9(10)8-11(15)14(17)18/h4-8,17-18H,1-3H3
SMILES:CC(C)(C)OC(=O)n1c2ccccc2cc1B(O)O
Synonyms:- 1-(tert-Butoxycarbonyl)indole-2-boronic acid
- 1-(tert-Butoxycarbonyl)-1H-indol-2-ylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Boc-indole-2-boronic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C13H16BNO4Purity:95%Color and Shape:White to cream to pale brown or pink, Crystals or powder or crystalline powderMolecular weight:261.08N-Boc-indole-2-boronic Acid
CAS:Formula:C13H16BNO4Purity:95%Color and Shape:SolidMolecular weight:261.08141H-Indole-2-boronic acid, N-BOC protected
CAS:1H-Indole-2-boronic acid, N-BOC protectedFormula:C13H16BNO4Purity:98%Color and Shape:White Fine PowderMolecular weight:261.08g/mol1-(tert-Butoxycarbonyl)indole-2-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C13H16BNO4Purity:97.0 to 108.0 %Color and Shape:White to Orange to Green powder to crystalMolecular weight:261.08(1-(tert-Butoxycarbonyl)-1H-indol-2-yl)boronic acid
CAS:Formula:C13H16BNO4Purity:95%Color and Shape:SolidMolecular weight:261.08




