CymitQuimica logo

CAS 21333-20-0

:

6-[(1-phenylethyl)amino]pyrimidine-2,4(1H,3H)-dione

Description:
6-[(1-phenylethyl)amino]pyrimidine-2,4(1H,3H)-dione, identified by its CAS number 21333-20-0, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted at the 6-position with an amino group that is further substituted with a 1-phenylethyl group, contributing to its unique properties. The presence of the dione functional groups at the 2 and 4 positions indicates that it has two carbonyl groups, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its structure suggests potential biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. Additionally, the phenylethyl moiety may enhance lipophilicity, influencing the compound's pharmacokinetic properties. Overall, this compound's characteristics make it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C12H13N3O2
InChI:InChI=1/C12H13N3O2/c1-8(9-5-3-2-4-6-9)13-10-7-11(16)15-12(17)14-10/h2-8H,1H3,(H3,13,14,15,16,17)
SMILES:CC(c1ccccc1)Nc1cc(nc(n1)O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.