CAS 213386-94-8

[3-(methoxymethoxy)phenyl]-(3-pyridyl)methanone

Description:

[3-(Methoxymethoxy)phenyl]-(3-pyridyl)methanone, with the CAS number 213386-94-8, is an organic compound characterized by its complex structure that includes both phenyl and pyridyl groups. This compound features a methanone functional group, which is indicative of its ketone nature, and it contains methoxy substituents that enhance its solubility and reactivity. The presence of the methoxymethoxy group suggests potential for hydrogen bonding and influences its electronic properties, making it a candidate for various chemical reactions. The pyridyl moiety contributes to the compound's aromatic character and may also affect its biological activity. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific interactions and reactivity of this compound can be influenced by its substituents, making it a subject of interest in medicinal chemistry and materials science. Overall, its unique structural features provide a foundation for exploring its chemical behavior and potential applications.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1/C14H13NO3/c1-17-10-18-13-6-2-4-11(8-13)14(16)12-5-3-7-15-9-12/h2-9H,10H2,1H3

SMILES: COCOc1cccc(c1)C(=O)c1cccnc1

[3-(methoxymethoxy)phenyl](pyridin-3-yl)methanone

CAS: 213386-94-8

Formula: C₁₄H₁₃NO₃

Purity: 95.0%

Molecular weight: 243.262

Ref: 10-F308014