CAS 21339-73-1

4-amino-2,5-dimethylbenzoic acid

Description:

4-Amino-2,5-dimethylbenzoic acid, also known as 4-amino-2,5-xylobenzoic acid, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a benzene ring that also features two methyl groups at the 2 and 5 positions. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in water and organic solvents, which is influenced by the presence of the polar functional groups. It has applications in various fields, including pharmaceuticals and dye synthesis, due to its ability to participate in electrophilic substitution reactions and its potential as a building block for more complex molecules. The presence of the amino group allows for further derivatization, making it a versatile compound in organic synthesis. Additionally, its structural features contribute to its biological activity, which may include antimicrobial properties. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₉H₁₁NO₂

InChI: InChI=1/C9H11NO2/c1-5-4-8(10)6(2)3-7(5)9(11)12/h3-4H,10H2,1-2H3,(H,11,12)

SMILES: Cc1cc(c(C)cc1C(=O)O)N

4-Amino-2,5-dimethylbenzoic acid

CAS: 21339-73-1

Formula: C₉H₁₁NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 165.1891

Ref: IN-DA007QS8

4-Amino-2,5-dimethylbenzoic acid

CAS: 21339-73-1

4-Amino-2,5-dimethylbenzoic acid

Purity: 97%

Molecular weight: 165.19g/mol

Ref: 54-OR74756

4-Amino-2,5-dimethylbenzoic acid

CAS: 21339-73-1

Formula: C₉H₁₁NO₂

Purity: 97%

Molecular weight: 165.192

Ref: 10-F464069