CymitQuimica logo

CAS 213412-32-9

:

2-(4-methoxyphenoxy)propanehydrazide

Description:
2-(4-Methoxyphenoxy)propanehydrazide, identified by its CAS number 213412-32-9, is a chemical compound that features a hydrazide functional group attached to a propane backbone, with a methoxy-substituted phenoxy group. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its hydrazide moiety, which can exhibit biological activity. The presence of the methoxy group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the phenoxy group may contribute to the compound's reactivity and interaction with various biological targets. The structural characteristics suggest that it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. As with many hydrazides, it may also be involved in various chemical reactions, including condensation and oxidation, making it a versatile compound in synthetic organic chemistry. However, specific safety and handling information should be consulted from reliable sources when working with this substance.
Formula:C10H14N2O3
InChI:InChI=1/C10H14N2O3/c1-7(10(13)12-11)15-9-5-3-8(14-2)4-6-9/h3-7H,11H2,1-2H3,(H,12,13)
InChI key:HKQMXFGVOKBZSS-UHFFFAOYSA-N
SMILES:CC(C(=NN)O)Oc1ccc(cc1)OC
Synonyms:
  • Propanoic Acid, 2-(4-Methoxyphenoxy)-, Hydrazide
Found 2 products.