CAS 21344-31-0

Thieno[2,3-b]pyridine-5-carbonitrile

Description:

Thieno[2,3-b]pyridine-5-carbonitrile is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. The presence of a cyano group (-C≡N) at the 5-position of the pyridine ring enhances its reactivity and makes it a valuable intermediate in organic synthesis. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. Its structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with thieno and pyridine derivatives. Additionally, the compound may exhibit interesting electronic properties, making it a candidate for use in materials science, such as organic semiconductors. Safety data indicates that, like many nitriles, it should be handled with care due to potential toxicity and irritant properties. Overall, Thieno[2,3-b]pyridine-5-carbonitrile is a versatile compound with significant implications in various fields of chemical research.

Formula: C₈H₄N₂S

InChI: InChI=1S/C8H4N2S/c9-4-6-3-7-1-2-11-8(7)10-5-6/h1-3,5H

InChI key: InChIKey=IOVJNINZHOJSDD-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C2C(=NC1)SC=C2

Synonyms:

• Thieno[2,3-b]pyridine-5-carbonitrile

THIENO[2,3-B]PYRIDINE-5-CARBONITRILE

CAS: 21344-31-0

Formula: C₈H₄N₂S

Purity: 98%

Molecular weight: 160.1958

Ref: IN-DA00BJ55

Thieno[2,3-b]pyridine-5-carbonitrile

CAS: 21344-31-0

Thienopyridine analogs are a class of chemical compounds that function as agonists of the receptor α. These compounds have been shown to inhibit fatty acid oxidation and ATP production in rat liver cells, which may be due to their ability to activate AMP-activated protein kinase (AMPK). Thienopyridine analogs are being investigated for use as anti-inflammatory agents and cancer treatments.

Formula: C₈H₄N₂S

Purity: Min. 95%

Molecular weight: 160.2 g/mol

Ref: 3D-WAA34431