CAS 21344-73-0

4-phenyl-N-(prop-2-en-1-yl)-1,3-thiazol-2-amine

Description:

4-Phenyl-N-(prop-2-en-1-yl)-1,3-thiazol-2-amine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a phenyl group and an allyl substituent, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The thiazole moiety is known for its biological activity, often serving as a scaffold in drug development. The presence of the amine functional group suggests potential for hydrogen bonding and interactions with biological targets. Additionally, the compound's structure may influence its solubility, stability, and overall reactivity, making it of interest in various chemical and pharmaceutical contexts. Its CAS number, 21344-73-0, allows for easy identification and retrieval of information in chemical databases. Overall, this compound exemplifies the diverse chemistry of thiazoles and their derivatives, highlighting their significance in both synthetic and applied chemistry.

Formula: C₁₂H₁₂N₂S

InChI: InChI=1/C12H12N2S/c1-2-8-13-12-14-11(9-15-12)10-6-4-3-5-7-10/h2-7,9H,1,8H2,(H,13,14)

SMILES: C=CCN=c1[nH]c(cs1)c1ccccc1

Synonyms:

• 2-thiazolamine, 4-phenyl-N-2-propen-1-yl-
• N-Allyl-4-phenyl-1,3-thiazol-2-amine

4-Phenyl-N-(prop-2-en-1-yl)-1,3-thiazol-2-amine

CAS: 21344-73-0

Versatile small molecule scaffold

Formula: C₁₂H₁₂N₂S

Purity: Min. 95%

Molecular weight: 216.3 g/mol

Ref: 3D-WAA34473