CAS 213462-12-5
:4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine
Description:
4-(4-Chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a thieno[3,2-c]pyridine core fused with a tetrahydro configuration. The presence of a 4-chlorophenyl group enhances its lipophilicity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocycles. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic components that can interact with biological targets. The compound may also exhibit interesting pharmacological properties, making it a subject of research in various therapeutic areas. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Overall, 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine represents a valuable compound in the field of organic and medicinal chemistry.
Formula:C13H12ClNS
InChI:InChI=1/C13H12ClNS/c14-10-3-1-9(2-4-10)13-11-6-8-16-12(11)5-7-15-13/h1-4,6,8,13,15H,5,7H2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-(4-Chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine
CAS:4-(4-Chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine
Purity:≥95%Molecular weight:249.76g/mol4-(4-Chlorophenyl)-4H,5H,6H,7H-thieno[3,2-c]pyridine
CAS:4-(4-Chlorophenyl)-4H,5H,6H,7H-thieno[3,2-c]pyridine is a thiophene derivative that has been used as an imine. It is a protonated molecule with strong metal ion affinity and can be used to bind to Alzheimer's disease or obsessive compulsive disorder. 4-(4-Chlorophenyl)-4H,5H,6H,7H-thieno[3,2-c]pyridine has been shown to inhibit the activity of acetylcholinesterase by binding to the active site of this enzyme. This inhibition leads to an increase in the levels of acetylcholine in the brain and an increase in the number of neurons activated. 4-(4-Chlorophenyl)-4H,5H,6H,7H-thieno[3,2-c]pyridine also inhibits serotonin
Formula:C13H12ClNSPurity:Min. 95%Molecular weight:249.76 g/mol

