CAS 213462-19-2

4-(4-methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine

Description:

4-(4-Methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine is a heterocyclic organic compound characterized by its complex structure, which includes a thieno[3,2-c]pyridine core fused with a methoxyphenyl group. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its stability and potential biological activity. The methoxy group (-OCH3) enhances its lipophilicity and may influence its interaction with biological targets. The thieno[3,2-c]pyridine moiety is known for its pharmacological properties, often associated with neuroactive and anti-inflammatory effects. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its CAS number, 213462-19-2, allows for precise identification and retrieval of information regarding its properties, synthesis, and potential uses in research and industry. Overall, this compound exemplifies the diverse chemistry of heterocycles and their significance in drug discovery.

Formula: C₁₄H₁₅NOS

InChI: InChI=1/C14H15NOS/c1-16-11-4-2-10(3-5-11)14-12-7-9-17-13(12)6-8-15-14/h2-5,7,9,14-15H,6,8H2,1H3

SMILES: COc1ccc(cc1)C1c2ccsc2CCN1

4-(4-Methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine

CAS: 213462-19-2

4-(4-Methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine

Formula: C₁₄H₁₅NOS

Purity: tech

Color and Shape: white/cream solid

Molecular weight: 245.34g/mol

Ref: 54-OR8111

4-(4-methoxyphenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine

CAS: 213462-19-2

Formula: C₁₄H₁₅NOS

Purity: 95%

Molecular weight: 245.34

Ref: 10-F518991