
CAS 2136287-67-5
:(12aR)-7-(Hexyloxy)-3,4,12,12a-tetrahydro-1H-[1,4]oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazine-6,8-dione
Description:
The chemical substance with the name "(12aR)-7-(Hexyloxy)-3,4,12,12a-tetrahydro-1H-[1,4]oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazine-6,8-dione" and CAS number "2136287-67-5" is a complex organic compound characterized by its unique structural features, including a fused oxazino and pyrido-triazine framework. This compound likely exhibits a range of biological activities due to its intricate molecular architecture, which may influence its interactions with biological targets. The presence of a hexyloxy substituent suggests potential lipophilicity, which could enhance its membrane permeability and bioavailability. Additionally, the tetrahydro structure indicates that it may exist in a specific stereochemical configuration, potentially affecting its pharmacological properties. Such compounds are often investigated for their potential therapeutic applications, including roles in medicinal chemistry and drug development. However, detailed studies on its specific properties, such as solubility, stability, and biological activity, would be necessary to fully understand its potential uses and implications in various fields.
Formula:C16H23N3O4
InChI:InChI=1S/C16H23N3O4/c1-2-3-4-5-9-23-15-12(20)6-7-19-14(15)16(21)18-8-10-22-11-13(18)17-19/h6-7,13,17H,2-5,8-11H2,1H3/t13-/m0/s1
InChI key:InChIKey=VYAAQVJEPLIPQB-ZDUSSCGKSA-N
SMILES:O(CCCCCC)C1=C2N(N[C@]3(N(C2=O)CCOC3)[H])C=CC1=O
Synonyms:- 1H-[1,4]Oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazine-6,8-dione, 7-(hexyloxy)-3,4,12,12a-tetrahydro-, (12aR)-
- (12aR)-7-(Hexyloxy)-3,4,12,12a-tetrahydro-1H-[1,4]oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazine-6,8-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
