CAS 21370-71-8
:rel-(4aR,8aS)-Octahydro-1(2H)-naphthalenone
Description:
Rel-(4aR,8aS)-Octahydro-1(2H)-naphthalenone, with the CAS number 21370-71-8, is a bicyclic organic compound characterized by its unique structure, which consists of a naphthalene derivative with a saturated ring system. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The stereochemistry indicated by the rel-(4aR,8aS) designation suggests specific spatial arrangements of the atoms, which can influence its physical and chemical properties, such as boiling point, melting point, and solubility. Typically, compounds of this type may exhibit interesting biological activities, making them of interest in medicinal chemistry. Additionally, the presence of multiple chiral centers can lead to the existence of various stereoisomers, which may have different properties and activities. Overall, rel-(4aR,8aS)-Octahydro-1(2H)-naphthalenone represents a structurally complex molecule with potential utility in various chemical and pharmaceutical applications.
Formula:C10H16O
InChI:InChI=1/C10H16O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h8-9H,1-7H2/t8-,9+/s2
InChI key:InChIKey=AFEFRXAPJRCTOW-BRJQIKQINA-N
SMILES:O=C1[C@@]2([C@@](CCC1)(CCCC2)[H])[H]
Synonyms:- (4aR,8aS)-octahydronaphthalen-1(2H)-one
- 1(2H)-Naphthalenone, octahydro-, (4aR,8aS)-rel-
- 1(2H)-Naphthalenone, octahydro-, trans-
- Trans-Bicyclo(4.4.0)Decan-1-One
- octahydronaphthalen-1(2H)-one
- rel-(4aR,8aS)-Octahydro-1(2H)-naphthalenone
- trans-Decahydro-1-naphthalenone
- trans-α-Decalone
- trans-1-Decalone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
