CymitQuimica logo

CAS 213701-14-5

:

{4-[(trifluoroethenyl)oxy]phenyl}boronic acid

Description:
{4-[(Trifluoroethenyl)oxy]phenyl}boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a trifluoroethenyl ether. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications including organic synthesis and materials science. The trifluoroethenyl group introduces significant electron-withdrawing characteristics, which can influence the reactivity and stability of the compound. Additionally, the presence of fluorine atoms often enhances lipophilicity and can affect the compound's solubility in organic solvents. The compound may also exhibit interesting optical properties due to the conjugated system formed by the phenyl and trifluoroethenyl moieties. Overall, {4-[(trifluoroethenyl)oxy]phenyl}boronic acid is a versatile compound with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C8H6BF3O3
InChI:InChI=1/C8H6BF3O3/c10-7(11)8(12)15-6-3-1-5(2-4-6)9(13)14/h1-4,13-14H
SMILES:c1cc(ccc1B(O)O)OC(=C(F)F)F
Synonyms:
  • {4-[(Trifluorovinyl)oxy]phenyl}boronic acid
  • Boronic acid, B-[4-[(1,2,2-trifluoroethenyl)oxy]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.