CAS 213771-32-5
:Methyl 5-bromo-3-methylpyridine-2-carboxylate
Description:
Methyl 5-bromo-3-methylpyridine-2-carboxylate is a chemical compound characterized by its pyridine ring structure, which includes a bromine substituent and a carboxylate ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It has a molecular formula that reflects the presence of bromine, methyl, and carboxylate groups, contributing to its reactivity and potential applications in organic synthesis. The bromine atom enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. Additionally, the methyl groups can influence the compound's solubility and stability. Methyl 5-bromo-3-methylpyridine-2-carboxylate may be utilized in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals, owing to its functional groups that allow for further chemical modifications. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts associated with bromine-containing substances.
Formula:C8H8BrNO2
InChI:InChI=1/C8H8BrNO2/c1-5-3-6(9)4-10-7(5)8(11)12-2/h3-4H,1-2H3
SMILES:Cc1cc(cnc1C(=O)OC)Br
Synonyms:- 2-Pyridinecarboxylic Acid, 5-Bromo-3-Methyl-, Methyl Ester
- Methyl 5-Bromo-3-Methylpicolinate
- 5-Bromo-3-methylpyridine-2-carboxylic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 5-bromo-3-methylpicolinate
CAS:Formula:C8H8BrNO2Purity:98%Color and Shape:SolidMolecular weight:230.0586Methyl 5-bromo-3-methylpyridine-2-carboxylate
CAS:Methyl 5-bromo-3-methylpyridine-2-carboxylatePurity:99%Color and Shape:PowderMolecular weight:230.06g/molMethyl 5-bromo-3-methyl-pyridine-2-carboxylate
CAS:Formula:C8H8BrNO2Purity:98%Color and Shape:SolidMolecular weight:230.061Methyl 5-bromo-3-methylpicolinate
CAS:<p>Please enquire for more information about Methyl 5-bromo-3-methylpicolinate including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C8H8BrNO2Purity:Min. 95%Molecular weight:230.06 g/mol




