CAS 21381-61-3: 4-(4,5-dihydro-1H-imidazol-2-yl)pyridine

Description: 4-(4,5-dihydro-1H-imidazol-2-yl)pyridine, with the CAS number 21381-61-3, is a heterocyclic organic compound characterized by the presence of both a pyridine and an imidazole ring in its structure. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. Its molecular structure includes a pyridine ring, which contributes to its basicity and potential for forming coordination complexes, and a dihydroimidazole moiety, which can participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Overall, 4-(4,5-dihydro-1H-imidazol-2-yl)pyridine is a versatile compound with potential applications in pharmaceuticals and materials science.

Formula: C₈H₉N₃

InChI: InChI=1/C8H9N3/c1-3-9-4-2-7(1)8-10-5-6-11-8/h1-4H,5-6H2,(H,10,11)

Synonyms:

• pyridine, 4-(4,5-dihydro-1H-imidazol-2-yl)-

4-(4,5-Dihydroimidazol-2-yl)-pyridine

CAS: 21381-61-3

Versatile small molecule scaffold

• Formula: C₈H₉N₃
• Purity: Min. 95%
• Molecular weight: 147.18 g/mol

4-(4,5-Dihydroimidazol-2-yl)-pyridine

CAS: 21381-61-3

• Purity: 97%
• Molecular weight: 147.18099975585938