
CAS 21398-65-2
:2,3-Dihydro-N-propyl-1,4-benzodioxin-2-methanamine
Description:
2,3-Dihydro-N-propyl-1,4-benzodioxin-2-methanamine, with the CAS number 21398-65-2, is a chemical compound that belongs to the class of benzodioxins. This substance features a benzodioxin core structure, which consists of a fused benzene and dioxin ring, contributing to its unique chemical properties. The presence of a propyl group and a methanamine functional group indicates that it may exhibit amine-like reactivity, potentially participating in various chemical reactions such as alkylation or acylation. The compound's structure suggests it may have applications in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of pharmaceuticals. Additionally, its specific stereochemistry and functional groups could influence its biological activity, solubility, and interaction with biological targets. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses in various fields.
Formula:C12H17NO2
InChI:InChI=1S/C12H17NO2/c1-2-7-13-8-10-9-14-11-5-3-4-6-12(11)15-10/h3-6,10,13H,2,7-9H2,1H3
InChI key:InChIKey=NDBVZFMGYMXMQA-UHFFFAOYSA-N
SMILES:C(NCCC)C1OC=2C(OC1)=CC=CC2
Synonyms:- 1,4-Benzodioxan-2-methylamine, N-propyl-
- [(2,3-Dihydro-1,4-benzodioxin-2-yl)methyl](propyl)amine
- 1,4-Benzodioxin-2-methanamine, 2,3-dihydro-N-propyl-
- (2,3-Dihydro-1,4-benzodioxin-2-ylmethyl)(propyl)amine
- 2,3-Dihydro-N-propyl-1,4-benzodioxin-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.