CAS 21399-33-7

(1E)-bis[1-(4-methylphenyl)ethylidene]hydrazine

Description:

(1E)-bis[1-(4-methylphenyl)ethylidene]hydrazine, with the CAS number 21399-33-7, is an organic compound characterized by its hydrazine functional group and two ethylidene groups attached to a hydrazine backbone. This compound features a symmetrical structure, where each side of the hydrazine is substituted with a 4-methylphenyl group, contributing to its aromatic character. The presence of the ethylidene groups indicates that it has double bonds, which can influence its reactivity and stability. Typically, compounds of this nature may exhibit properties such as moderate solubility in organic solvents and potential reactivity with electrophiles due to the presence of the nitrogen atoms in the hydrazine moiety. Additionally, the aromatic rings can provide stability and influence the compound's electronic properties. Such compounds may find applications in various fields, including materials science and organic synthesis, although specific applications would depend on further research into their reactivity and properties. Safety and handling precautions should be observed, as hydrazine derivatives can be hazardous.

Formula: C₁₈H₂₀N₂

InChI: InChI=1/C18H20N2/c1-13-5-9-17(10-6-13)15(3)19-20-16(4)18-11-7-14(2)8-12-18/h5-12H,1-4H3/b19-15+,20-16u

4--Methylacetophenone azine

CAS: 21399-33-7

4-Methylacetophenone azine is a useful chemical with a variety of applications. It is a versatile building block, which can be used as an intermediate for the synthesis of complex compounds and as a reaction component in organic synthesis. 4-Methylacetophenone azine has been shown to be effective in the production of research chemicals and speciality chemicals. This product is high quality and can be used as a reagent in organic synthesis.

Formula: C₁₈H₂₀N₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 264.36 g/mol

Ref: 3D-FM66885