CAS 213994-29-7

3-Chloro-α-(4-nitrophenyl)-5-(trifluoromethyl)-2-pyridineacetonitrile

Description:

3-Chloro-α-(4-nitrophenyl)-5-(trifluoromethyl)-2-pyridineacetonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring, a chloro substituent, a nitrophenyl group, and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of electron-withdrawing groups like the nitro and trifluoromethyl moieties. The chloro substituent can influence its solubility and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The presence of the nitrile functional group contributes to its polarity and potential applications in organic synthesis and medicinal chemistry. Additionally, the trifluoromethyl group is known to enhance biological activity and lipophilicity, which may be relevant in drug design. Overall, this compound's unique combination of functional groups suggests potential utility in pharmaceuticals or agrochemicals, although specific applications would depend on further research and development.

Formula: C₁₄H₇ClF₃N₃O₂

InChI: InChI=1S/C14H7ClF3N3O2/c15-12-5-9(14(16,17)18)7-20-13(12)11(6-19)8-1-3-10(4-2-8)21(22)23/h1-5,7,11H

InChI key: InChIKey=QKHYZVNJBQELIN-UHFFFAOYSA-N

SMILES: C(C#N)(C1=C(Cl)C=C(C(F)(F)F)C=N1)C2=CC=C(N(=O)=O)C=C2

Synonyms:

• 2-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]-2-(4-nitrophenyl)acetonitrile
• 3-Chloro-α-(4-nitrophenyl)-5-(trifluoromethyl)-2-pyridineacetonitrile
• 2-Pyridineacetonitrile, 3-chloro-α-(4-nitrophenyl)-5-(trifluoromethyl)-

2-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]-2-(4-nitrophenyl)acetonitrile

CAS: 213994-29-7

2-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]-2-(4-nitrophenyl)acetonitrile

Purity: 97%

Color and Shape: Solid

Molecular weight: 341.67g/mol

Ref: 54-PC8414