CAS 214-17-5: benzo(b)chrysene
Description:Benzo(b)chrysene is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex fused ring structure, which consists of five aromatic rings. It is a colorless to pale yellow solid at room temperature and is known for its hydrophobic nature, making it poorly soluble in water but soluble in organic solvents. This compound is primarily formed through the incomplete combustion of organic materials, such as fossil fuels and tobacco. Benzo(b)chrysene is of significant environmental concern due to its potential carcinogenic properties, as it can form DNA adducts that may lead to mutations. Its presence is often monitored in air, soil, and water due to its persistence in the environment and its ability to bioaccumulate in living organisms. Additionally, it is used in research to study the effects of PAHs on human health and the environment. Safety precautions are essential when handling this substance, as it poses risks to human health and the ecosystem.
Formula:C22H14
InChI:InChI=1S/C22H14/c1-2-7-17-14-22-18(13-16(17)6-1)10-12-20-19-8-4-3-5-15(19)9-11-21(20)22/h1-14H
InChI key:InChIKey=YYGRIGYJXSQDQB-UHFFFAOYSA-N
SMILES:C=1C=CC=2C=C3C(C=CC=4C=5C=CC=CC5C=CC43)=CC2C1
- Synonyms:
- 1,2:6,7-Dibenzophenanthrene
- 2,3-Benzochrysene
- 2,3:7,8-Dibenzophenanthrene
- 3,4-Benzotetracene
- 3,4-Benzotetraphene
- Benzo[C]Tetraphene
- Benzo[b]chrysene (purity)
- NSC 89274
- Naphth[2,1-a]anthracene

Benzo[b]chrysene 10 µg/mL in Cyclohexane
Ref: 04-L20550000CY
10ml | 71.00 € |

Benzo[b]chrysene 10 µg/mL in Acetonitrile
Ref: 04-L20550000AL
10ml | 66.00 € |

Benzo[b]chrysene 100 µg/mL in Toluene
Controlled ProductRef: 04-XA20550000TO
1ml | 44.00 € |

Benzo(b)chrysene
Controlled ProductRef: TR-B217000
5mg | 212.00 € | ||
50mg | 1,561.00 € |

Benzo[b]chrysene
Ref: 3D-FB146196
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |