CAS 2140-03-6
:N-(Iminomethyl)glycine
Description:
N-(Iminomethyl)glycine, also known as sarcosine, is an amino acid derivative characterized by its structure, which includes an amino group, a carboxylic acid group, and an iminomethyl substituent. This compound is a zwitterion at physiological pH, meaning it has both a positive and a negative charge, contributing to its solubility in water. It is often used in biochemical research and has been studied for its potential roles in various metabolic processes. N-(Iminomethyl)glycine is known for its involvement in the synthesis of other important biomolecules and may have implications in neurochemistry, particularly in relation to neurotransmitter systems. Additionally, it has been investigated for its potential therapeutic applications, including its effects on mental health and cognitive function. The compound is typically stable under standard laboratory conditions, but like many amino acids, it can be sensitive to extreme pH and temperature conditions. Its CAS number, 2140-03-6, is a unique identifier that facilitates its recognition in chemical databases and literature.
Formula:C3H6N2O2
InChI:InChI=1S/C3H6N2O2/c4-2-5-1-3(6)7/h2H,1H2,(H2,4,5)(H,6,7)
InChI key:InChIKey=LLKCTZRWBHOKFF-UHFFFAOYSA-N
SMILES:C(C(O)=O)NC=N
Synonyms:- N-(Iminomethyl)glycine
- Formimidoylglycine
- Glycine, N-formimidoyl-
- Glycine, N-(iminomethyl)-
- Formiminoglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
