CAS 2140-61-6: 5-Methylcytidine
Description:5-Methylcytidine is a nucleoside derivative of cytidine, characterized by the presence of a methyl group at the 5-position of the pyrimidine ring. This modification plays a significant role in various biological processes, particularly in the regulation of gene expression and RNA stability. It is commonly found in RNA molecules, especially in tRNA and rRNA, where it contributes to the structural integrity and function of these essential biomolecules. The presence of the methyl group can influence the interaction of RNA with proteins and other nucleic acids, thereby affecting cellular processes such as translation and transcription. 5-Methylcytidine is also involved in epigenetic regulation, as it can be a marker for DNA methylation patterns. In terms of physical properties, it is typically a white to off-white crystalline solid, soluble in water, and exhibits stability under physiological conditions. Its chemical formula is C₈H₁₁N₃O₅, and it is utilized in various biochemical and molecular biology applications, including studies on RNA modifications and epigenetics.
Formula:C10H15N3O5
InChI:InChI=1S/C10H15N3O5/c1-4-2-13(10(17)12-8(4)11)9-7(16)6(15)5(3-14)18-9/h2,5-7,9,14-16H,3H2,1H3,(H2,11,12,17)/t5-,6-,7-,9-/m1/s1
InChI key:InChIKey=ZAYHVCMSTBRABG-JXOAFFINSA-N
SMILES:O=C1N=C(N)C(=CN1C2OC(CO)C(O)C2O)C
- Synonyms:
- 4-amino-5-methyl-1-pentofuranosylpyrimidin-2(1H)-one
- Cytidine, 5-methyl-
- Nsc 363933
- 5-Methylcytidine
- 3: PN: US20060035254 PAGE: 63 claimed sequence
