CAS 2140-64-9
:3-Methylcytidine
Description:
3-Methylcytidine is a modified nucleoside that is a derivative of cytidine, characterized by the presence of a methyl group at the 3-position of the ribose sugar. This modification can influence the stability and functionality of RNA molecules, as it may affect base pairing and the overall structure of RNA. 3-Methylcytidine is often found in various biological contexts, including in certain tRNA molecules and as a product of RNA methylation processes, which play crucial roles in gene expression regulation and RNA processing. The chemical formula of 3-Methylcytidine reflects its composition of carbon, hydrogen, nitrogen, and oxygen atoms, typical of nucleosides. Its presence in cellular systems can impact the dynamics of RNA metabolism and has implications in studies related to epigenetics and cellular signaling. Additionally, 3-Methylcytidine can be utilized in research and therapeutic applications, particularly in the development of RNA-based drugs and in understanding the mechanisms of RNA modifications in various biological processes.
Formula:C10H15N3O5
InChI:InChI=1S/C10H15N3O5/c1-12-6(11)2-3-13(10(12)17)9-8(16)7(15)5(4-14)18-9/h2-3,5,7-9,11,14-16H,4H2,1H3/t5-,7-,8-,9-/m1/s1
InChI key:InChIKey=RDPUKVRQKWBSPK-ZOQUXTDFSA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=O)N(C)C(=N)C=C2
Synonyms:- Cytidine, 3-methyl-
- N3-Methylcytidine
- 3-Methylcytidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Methylcytidine
CAS:<p>3-Methylcytidine as biomarkers of four different types of cancer: lung cancer, gastric cancer, colon cancer, and breast cancer.</p>Formula:C10H15N3O5Purity:99.52%Color and Shape:SolidMolecular weight:257.24N3-Methylcytidine
CAS:Controlled ProductFormula:C10H15N3O5Color and Shape:WhiteMolecular weight:257.24N3-Methylcytidine
CAS:<p>N3-Methylcytidine is a synthetic analog of uridine. It is used for the treatment of syncytial virus infection, which is a group of diseases caused by viruses that have an RNA genome and replicate by forming syncytia—large groups of infected cells. N3-Methylcytidine inhibits the synthesis of proteins in cells and inhibits the growth of bacteria. This drug has been shown to inhibit actin polymerization and prevents cell spreading. N3-Methylcytidine also binds to RNA polymerase II and blocks its interaction with DNA, inhibiting protein synthesis at the ribosome level. N3-Methylcytidine is metabolized in vivo into methylated cytidine, which can be detected in urine samples using chemical biology methods or fluorescence resonance energy transfer (FRET) analysis. Synonyms: N3-methyluridine; 3-methyluridine</p>Formula:C10H15N3O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:257.24 g/mol





