CAS 2140-65-0
:1-methylguanosine
Description:
1-Methylguanosine is a modified nucleoside derived from guanosine, characterized by the presence of a methyl group at the nitrogen-1 position of the guanine base. This modification can influence the stability and function of RNA molecules, particularly in the context of tRNA and mRNA. The chemical formula of 1-methylguanosine is C₁₃H₁₅N₅O₄, and it features a purine base linked to a ribose sugar, which is typical of nucleosides. This compound plays a significant role in various biological processes, including RNA processing and regulation, and is often involved in the formation of the 5' cap structure of eukaryotic mRNAs, which is crucial for mRNA stability and translation. Additionally, 1-methylguanosine can be found in certain tRNA molecules, where it contributes to the proper folding and function of the tRNA. Its presence in RNA can affect interactions with proteins and other nucleic acids, thereby influencing gene expression and cellular function.
Formula:C11H15N5O5
InChI:InChI=1/C11H15N5O5/c1-15-9(20)5-8(14-11(15)12)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14)/t4-,6-,7-,10-/m1/s1
InChI key:InChIKey=UTAIYTHAJQNQDW-KQYNXXCUSA-N
SMILES:Cn1c(=O)c2c([nH]c1=N)n(cn2)[C@H]1[C@@H]([C@@H]([C@@H](CO)O1)O)O
Synonyms:- 2-amino-1-methyl-9-pentofuranosyl-1,9-dihydro-6H-purin-6-one
- Guanosine, 1-Methyl-
- Methylguanosine
- N<sup>1</sup>-Methylguanosine
- NSC 70897
- 1-Methylguanosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N1-Methylguanosine
CAS:Formula:C11H15N5O5Purity:≥ 95.0%Color and Shape:White powderMolecular weight:297.271-Methylguanosine
CAS:1-Methylguanosine, a methylated nucleoside from RNA breakdown, shows abnormal urine levels in cancer patients.Formula:C11H15N5O5Purity:99.91%Color and Shape:SolidMolecular weight:297.27N1-Methylguanosine-CD3
CAS:Controlled ProductFormula:C11D3H12N5O5Color and Shape:NeatMolecular weight:300.286N1-Methylguanosine
CAS:Controlled Product<p>N1-Methylguanosine is a methylated nucleotide that is incorporated into the growing DNA chain during protein synthesis. The incorporation of N1-methylguanosine into the growing DNA chain can cause frameshifting, which creates an unusual amino acid sequence. This effect has been shown in model organisms, such as Saccharomyces cerevisiae and Escherichia coli. In these organisms, N1-methylguanosine has been shown to induce cancer when added to the growth medium. It is also found in urine samples from people with bladder cancer and has been used to identify urinary tract cancers. Titration calorimetry studies have shown that N1-methylguanosine binds to a chelate ligand and forms a disulfide bond with cysteine residues on proteins or peptides, which may lead to mitochondrial dysfunction by interfering with hydrogen bonding interactions. Messenger RNA studies show that N1-methylguanosine inhibits translation of mRNA by binding to</p>Formula:C11H15N5O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:297.27 g/mol






