CAS 2140-79-6: 2′-O-Methyladenosine
Description:2′-O-Methyladenosine (2′-O-MeA) is a modified nucleoside derived from adenosine, characterized by the presence of a methyl group at the 2′ position of the ribose sugar. This modification is significant in various biological processes, particularly in RNA biology, where it plays a role in the stability and function of RNA molecules. 2′-O-Methyladenosine is commonly found in tRNA and rRNA, contributing to the structural integrity and proper functioning of these essential biomolecules. The presence of the methyl group can influence the interaction of RNA with proteins and other nucleic acids, affecting processes such as translation and splicing. Additionally, 2′-O-Methyladenosine is of interest in the study of epitranscriptomics, as it is involved in the regulation of gene expression and cellular responses. Its CAS number, 2140-79-6, allows for easy identification in chemical databases. Overall, 2′-O-Methyladenosine is a crucial component in the complex landscape of RNA modifications, impacting various aspects of cellular function and regulation.
Formula:C11H15N5O4
InChI:InChI=1S/C11H15N5O4/c1-19-8-7(18)5(2-17)20-11(8)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7-,8-,11-/m1/s1
InChI key:InChIKey=FPUGCISOLXNPPC-IOSLPCCCSA-N
SMILES:OCC1OC(N2C=NC=3C(=NC=NC32)N)C(OC)C1O
- Synonyms:
- 2'-O-Methyl-adenosine
- 2'-OMe Adenosine
- Adenosine, 2'-O-methyl-
- Cordysinin B
- 2′-O-Methyladenosine
- (2R,3R,4R,5R)-5-(6-Amino-9H-purin-9-yl)-2-(hydroxymethyl)-4-methoxytetrahydrofuran-3-ol
