CAS 21403-24-7

N-(thiophen-2-ylmethyl)acetamide

Description:

N-(thiophen-2-ylmethyl)acetamide is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an acetamide functional group, indicating that it has both an amine and a carbonyl group, which contributes to its reactivity and potential biological activity. The thiophen-2-ylmethyl substituent suggests that the compound may exhibit unique electronic properties due to the conjugation between the thiophene and the acetamide moiety. Typically, compounds like this can be soluble in polar organic solvents and may exhibit moderate to high stability under standard conditions. The presence of the thiophene ring may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential for hydrogen bonding due to the amide group, which can influence its interactions in biological systems. Overall, N-(thiophen-2-ylmethyl)acetamide is a compound of interest for further research, particularly in the fields of organic synthesis and drug development.

Formula: C₇H₉NOS

InChI: InChI=1/C7H9NOS/c1-6(9)8-5-7-3-2-4-10-7/h2-4H,5H2,1H3,(H,8,9)

SMILES: CC(=NCc1cccs1)O

N-[(Thiophen-2-yl)methyl]acetamide

CAS: 21403-24-7

Versatile small molecule scaffold

Formula: C₇H₉NOS

Purity: Min. 95%

Molecular weight: 155.22 g/mol

Ref: 3D-WAA40324