CAS 2140316-43-2

4-Piperidinamine, 1-[(5-cyclobutyl-4-oxazolyl)methyl]-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-[(5-cyclobutyl-4-oxazolyl)methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and oxazole moieties, which contribute to its potential biological activity. The presence of the piperidine ring suggests that it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. The cyclobutyl group and the oxazole ring introduce additional structural complexity, potentially influencing the compound's pharmacological profile. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in areas related to neuropharmacology or other therapeutic fields. However, specific biological activities, toxicity, and detailed physicochemical properties would require further investigation through experimental studies and literature review.

Formula: C₁₃H₂₁N₃O·2ClH

InChI: InChI=1S/C13H21N3O.2ClH/c14-11-4-6-16(7-5-11)8-12-13(17-9-15-12)10-2-1-3-10;;/h9-11H,1-8,14H2;2*1H

InChI key: InChIKey=VDHMGYRTFINRMC-UHFFFAOYSA-N

SMILES: C(C1=C(OC=N1)C2CCC2)N3CCC(N)CC3.Cl

Synonyms:

• 4-Piperidinamine, 1-[(5-cyclobutyl-4-oxazolyl)methyl]-, hydrochloride (1:2)

1-[(5-cyclobutyl-1,3-oxazol-4-yl)methyl]piperidin-4-amine dihydrochloride

CAS: 2140316-43-2

Formula: C₁₃H₂₃Cl₂N₃O

Purity: 95.0%

Molecular weight: 308.25

Ref: 10-F541956