CymitQuimica logo

CAS 214045-84-8

:

1(2H)-Isoquinolinone, 6-fluoro-3,4-dihydro-

Description:
1(2H)-Isoquinolinone, 6-fluoro-3,4-dihydro- is a chemical compound characterized by its isoquinolinone structure, which features a bicyclic system comprising a benzene ring fused to a pyridine-like ring. The presence of a fluorine atom at the 6-position contributes to its unique reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water, depending on the specific functional groups present. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the isoquinolinone framework being associated with various biological activities. The dihydro form indicates the presence of additional hydrogen atoms, which may influence its stability and reactivity. As with many fluorinated compounds, it may exhibit enhanced metabolic stability and lipophilicity, making it an interesting candidate for further research in drug development and synthesis.
Formula:C9H8FNO
InChI:InChI=1S/C9H8FNO/c10-7-1-2-8-6(5-7)3-4-11-9(8)12/h1-2,5H,3-4H2,(H,11,12)
InChI key:QAYARJVVFMRVQJ-UHFFFAOYSA-N
SMILES:C1CNC(=O)C2=C1C=C(C=C2)F
Synonyms:
  • 6-Fluoro-3,4-dihydro-2H-isoquinolin-1-one
  • 6-Fluoro-3,4-dihydroisoquinolin-1(2H)-one
  • 6-Fluoro-3,4-Dihydro-1(2H)-Isoquinolinone
Found 4 products.