CAS 214045-85-9

6-fluoroisoquinolin-1(2H)-one

Description:

6-Fluoroisoquinolin-1(2H)-one is a heterocyclic organic compound characterized by its isoquinoline structure, which features a fused benzene and pyridine ring system. The presence of a fluorine atom at the 6-position of the isoquinoline ring significantly influences its chemical properties, including its reactivity and potential biological activity. This compound typically exhibits a pale yellow to off-white crystalline appearance and is soluble in organic solvents. Its molecular structure includes a carbonyl group, contributing to its potential as a precursor in various synthetic pathways. 6-Fluoroisoquinolin-1(2H)-one has garnered interest in medicinal chemistry due to its potential pharmacological applications, including antimicrobial and anticancer activities. The compound's unique electronic properties, stemming from the fluorine substitution, may enhance its interaction with biological targets. As with many heterocycles, it may also participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₆FNO

InChI: InChI=1/C9H6FNO/c10-7-1-2-8-6(5-7)3-4-11-9(8)12/h1-5H,(H,11,12)

SMILES: c1cc2c(cc[nH]c2=O)cc1F

1(2H)-Isoquinolinone,6-fluoro-(9CI)

CAS: 214045-85-9

Formula: C₉H₆FNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.1484

Ref: IN-DA00BHLY

6-Fluoroisoquinolin-1(2H)-one

CAS: 214045-85-9

6-Fluoroisoquinolin-1(2H)-one

Purity: 97%

Molecular weight: 163.15g/mol

Ref: 54-PC101122

6-Fluoroisoquinolin-1(2H)-one

CAS: 214045-85-9

Formula: C₉H₆FNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.151

Ref: 10-F093073