CAS 214047-00-4
:(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxy-butanoyl]amino]-3-hydroxy-butanoyl]amino]hexanoyl]amino]-3-hydroxy-propanoic acid
Description:
The chemical substance with the name "(2S)-2-[[[2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxy-butanoyl]amino]-3-hydroxy-butanoyl]amino]hexanoyl]amino]-3-hydroxy-propanoic acid" and CAS number "214047-00-4" is a complex peptide derivative characterized by multiple amino acid residues and functional groups. This compound features a series of chiral centers, indicating that it exists in specific stereoisomeric forms, which can significantly influence its biological activity and interactions. The presence of amino groups suggests potential for hydrogen bonding and reactivity, while the hexadecanoylamino group indicates a fatty acid moiety that may enhance membrane permeability or lipophilicity. Additionally, the incorporation of hydroxy groups contributes to its solubility and potential for forming hydrogen bonds. Overall, this substance is likely to exhibit significant biological relevance, possibly in therapeutic applications, due to its structural complexity and the presence of functional groups that can interact with biological systems.
Formula:C39H75N7O10
InChI:InChI=1/C39H75N7O10/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-23-32(50)42-29(21-17-19-24-40)36(52)45-34(28(3)49)38(54)46-33(27(2)48)37(53)43-30(22-18-20-25-41)35(51)44-31(26-47)39(55)56/h27-31,33-34,47-49H,4-26,40-41H2,1-3H3,(H,42,50)(H,43,53)(H,44,51)(H,45,52)(H,46,54)(H,55,56)/t27?,28?,29-,30-,31-,33-,34-/m0/s1
SMILES:CCCCCCCCCCCCCCCC(=N[C@@H](CCCCN)C(=N[C@@H](C(C)O)C(=N[C@@H](C(C)O)C(=N[C@@H](CCCCN)C(=N[C@@H](CO)C(=O)O)O)O)O)O)O
Synonyms:- L-serine, N2
- N2
- Matrixyl Acetate
- L-Serine, N2-(1-Oxohexadecyl)-L-Lysyl-L-Threonyl-L-Threonyl-L-Lysyl-
- Palmitoyl Pentapeptide
- Pal-Kttks
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
L-Serine, N2-(1-oxohexadecyl)-L-lysyl-L-threonyl-L-threonyl-L-lysyl-
CAS:Formula:C39H75N7O10Purity:97%Color and Shape:SolidMolecular weight:802.0537Matrixyl
CAS:<p>Matrixyl (PAL-Lys-Thr-Thr-Lys-Ser) is a matrikine used in anti-wrinkle cosmetics.</p>Formula:C39H75N7O10Color and Shape:SolidMolecular weight:802.05Matrixyl
CAS:Formula:C39H75N7O10Purity:95%~98%Color and Shape:White to Off-white PowderMolecular weight:802.054Palmitoyl pentapeptide 4 acetate
CAS:<p>Palmitoyl pentapeptide 4 acetate is a medicinal compound that has been shown to have anticancer properties. It works by inducing apoptosis, or programmed cell death, in cancer cells. This compound has been used in traditional Chinese medicine to treat various types of tumors. Palmitoyl pentapeptide 4 acetate acts as an inhibitor of kinases, which are enzymes that play a crucial role in the regulation of cell growth and division. It has been shown to be effective against multiple types of cancer cells, including those found in the urine. This compound is an analog of a natural protein kinase inhibitor and is often used in combination with other inhibitors for maximum effect.</p>Formula:C39H75N7O10•(C2H4O2)xPurity:Min. 95%Color and Shape:PowderPalmitoyl pentapeptide trifluoroacetic acid
CAS:<p>Palmitoyl pentapeptide trifluoroacetic acid is a synthetic molecule that has been shown to have antimicrobial and anti-inflammatory properties. It has been shown to reduce the activity of gsh-px, which is an enzyme involved in the metabolism of glutathione. This compound also inhibits the production of ATP in cells, which may be responsible for its cancer-inhibiting effects. Palmitoyl pentapeptide trifluoroacetic acid has been shown to inhibit skin cancer cell growth by interfering with fatty acid synthesis and increasing epidermal growth factor levels.</p>Formula:C41H76N7O12Purity:Min. 95%Color and Shape:PowderMolecular weight:802.05 g/mol






