CAS 214047-00-4: (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxy-butanoyl]amino]-3-hydroxy-butanoyl]amino]hexanoyl]amino]-3-hydroxy-propanoic acid
Description:The chemical substance with the name "(2S)-2-[[[2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-(hexadecanoylamino)hexanoyl]amino]-3-hydroxy-butanoyl]amino]-3-hydroxy-butanoyl]amino]hexanoyl]amino]-3-hydroxy-propanoic acid" and CAS number "214047-00-4" is a complex peptide derivative characterized by multiple amino acid residues and functional groups. This compound features a series of chiral centers, indicating that it exists in specific stereoisomeric forms, which can significantly influence its biological activity and interactions. The presence of amino groups suggests potential for hydrogen bonding and reactivity, while the hexadecanoylamino group indicates a fatty acid moiety that may enhance membrane permeability or lipophilicity. Additionally, the incorporation of hydroxy groups contributes to its solubility and potential for forming hydrogen bonds. Overall, this substance is likely to exhibit significant biological relevance, possibly in therapeutic applications, due to its structural complexity and the presence of functional groups that can interact with biological systems.
Formula:C39H75N7O10
InChI:InChI=1/C39H75N7O10/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-23-32(50)42-29(21-17-19-24-40)36(52)45-34(28(3)49)38(54)46-33(27(2)48)37(53)43-30(22-18-20-25-41)35(51)44-31(26-47)39(55)56/h27-31,33-34,47-49H,4-26,40-41H2,1-3H3,(H,42,50)(H,43,53)(H,44,51)(H,45,52)(H,46,54)(H,55,56)/t27?,28?,29-,30-,31-,33-,34-/m0/s1
- Synonyms:
- L-serine, N2
- N2
- Matrixyl Acetate
- L-Serine, N2-(1-Oxohexadecyl)-L-Lysyl-L-Threonyl-L-Threonyl-L-Lysyl-
- Palmitoyl Pentapeptide
- Pal-Kttks