CAS 214074-24-5

rel-(1R,2S,3R,4S)-1,2,7,7-Tetramethylbicyclo[2.2.1]heptane-2,3-diol

Description:

Rel-(1R,2S,3R,4S)-1,2,7,7-Tetramethylbicyclo[2.2.1]heptane-2,3-diol is a bicyclic organic compound characterized by its unique bicyclo[2.2.1]heptane structure, which consists of two fused cyclopropane rings. This compound features four methyl groups and two hydroxyl (–OH) groups, contributing to its stereochemistry and potential reactivity. The specific stereochemistry indicated by the (1R,2S,3R,4S) configuration suggests that it has multiple chiral centers, which can influence its physical and chemical properties, such as solubility, boiling point, and reactivity. The presence of hydroxyl groups typically enhances hydrogen bonding capabilities, potentially affecting its interactions with other molecules. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its structural complexity and potential biological activity. However, detailed studies on its specific properties, such as melting point, solubility, and reactivity, would be necessary to fully characterize its behavior in different environments.

Formula: C₁₁H₂₀O₂

InChI: InChI=1/C11H20O2/c1-9(2)7-5-6-10(9,3)11(4,13)8(7)12/h7-8,12-13H,5-6H2,1-4H3/t7-,8-,10-,11-/s2

InChI key: InChIKey=GROZVIRKNWHGSN-QVEJRMLYNA-N

SMILES: C[C@@]12C(C)(C)[C@@]([C@@H](O)[C@@]1(C)O)(CC2)[H]

Synonyms:

• Bicyclo[2.2.1]heptane-2,3-diol, 1,2,7,7-tetramethyl-, (1R,2S,3R,4S)-rel-
• rel-(1R,2S,3R,4S)-1,2,7,7-Tetramethylbicyclo[2.2.1]heptane-2,3-diol

3-Hydroxy-2-Methyl Isoborneol-d3

CAS: 214074-24-5

Formula: C₁₁H₁₇D₃O₂

Molecular weight: 187.30

Ref: 4Z-P-265008

3-Hydroxy-2-methyl Isoborneol-D₃

Controlled Product

CAS: 214074-24-5

Formula: C₁₁D₃H₁₇O₂

Color and Shape: Neat

Molecular weight: 187.294

Ref: TR-H947937

3-Hydroxy-2-methyl Isoborneol

Controlled Product

CAS: 214074-24-5

Formula: C₁₁H₂₀O₂

Color and Shape: Neat

Molecular weight: 184.275

Ref: TR-H947935