CAS 21413-15-0
:6-chlorotetrazolo[1,5-b]pyridazine
Description:
6-Chlorotetrazolo[1,5-b]pyridazine is a heterocyclic compound characterized by its unique structure, which includes a tetrazole ring fused to a pyridazine moiety. This compound features a chlorine atom at the 6-position of the tetrazole ring, contributing to its chemical reactivity and potential applications in various fields. The presence of both nitrogen and chlorine atoms in its structure enhances its polarity and solubility in polar solvents, making it suitable for various chemical reactions. It is often studied for its potential biological activities, including antimicrobial and antitumor properties, due to the presence of the tetrazole ring, which is known for its pharmacological significance. Additionally, the compound may exhibit interesting electronic properties, making it a candidate for research in materials science and organic electronics. As with many nitrogen-containing heterocycles, it may also participate in coordination chemistry, forming complexes with metal ions. Overall, 6-chlorotetrazolo[1,5-b]pyridazine represents a versatile scaffold for further chemical exploration and development.
Formula:C4H2ClN5
InChI:InChI=1/C4H2ClN5/c5-3-1-2-4-6-8-9-10(4)7-3/h1-2H
SMILES:c1cc2nnnn2nc1Cl
Synonyms:- Tetrazolo[1,5-b]pyridazine, 6-chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6-Chlorotetrazolo[1,5-b]pyridazine
CAS:Formula:C4H2ClN5Purity:97%Color and Shape:SolidMolecular weight:155.54526-Chloro-[1,2,3,4]tetrazolo[1,5-b]pyridazine
CAS:Formula:C4H2ClN5Purity:95.0%Color and Shape:No data available.Molecular weight:155.556-Chlorotetrazolo[1,5-b]pyridazine
CAS:6-Chlorotetrazolo[1,5-b]pyridazine is a heterocyclic compound that belongs to the morpholine class. It is an important building block for the synthesis of many other heterocycles. The compound can be used as a chiral reagent in organic chemistry, due to its ability to form an enantiomeric pair with itself. 6-Chlorotetrazolo[1,5-b]pyridazine is also useful in the production of x-ray contrast agents that are used in radiography and computed tomography. In addition, it can be used as a substrate for the formation of carbohydrates through substitution reactions with methyl groups. 6-Chlorotetrazolo[1,5-b]pyridazine has been shown to be able to bind nucleophiles such as water and dimethylamine, which can lead to stereoselective reactions.Formula:C4H2ClN5Purity:Min. 95%Molecular weight:155.55 g/mol


