CAS 214139-20-5
:DL-3-Aminoisobutyric acid hydrate
Description:
DL-3-Aminoisobutyric acid hydrate, with the CAS number 214139-20-5, is an amino acid derivative characterized by its structural features that include an amino group, a carboxylic acid group, and a branched isobutyric acid backbone. This compound exists as a hydrate, indicating the presence of water molecules associated with its crystalline form. It is typically a white to off-white solid and is soluble in water, which is a common trait for many amino acids. The presence of both amino and carboxylic functional groups allows it to participate in various biochemical reactions, making it relevant in fields such as pharmaceuticals and biochemistry. Its properties may include moderate melting points and stability under standard conditions, although specific thermal and solubility characteristics can vary. As a compound, it may serve as a building block in peptide synthesis or as a potential therapeutic agent, although its specific applications would depend on ongoing research and development in medicinal chemistry.
Formula:C4H11NO3
InChI:InChI=1/C4H9NO2.H2O/c1-3(2-5)4(6)7;/h3H,2,5H2,1H3,(H,6,7);1H2
SMILES:CC(CN)C(=O)O.O
Synonyms:- 3-Amino-2-Methyl-Propanoic Acid Hydrate
- 3-Amino-2-Methyl-Propionic Acid Hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Amino-2-methylpropionic acid hydrate
CAS:Formula:C4H11NO3Purity:95%Color and Shape:SolidMolecular weight:121.13503-Amino-2-methylpropanoic acid hydrate
CAS:3-Amino-2-methylpropanoic acid hydratePurity:95%Molecular weight:121.14g/mol3-Amino-2-methyl-propionic acid hydrate
CAS:Formula:C4H11NO3Purity:95%Color and Shape:SolidMolecular weight:121.136DL-3-Aminoisobutyric Acid Hydrate
CAS:Controlled ProductApplications DL-3-aminoisobutyric acid hydrate is a useful research chemical for organic synthesis and other chemical processes.
References Saito, N., et al.: Bunseki Kagaku, 63, 909 (2014)Formula:C4H9NO2·H2OColor and Shape:NeatMolecular weight:103.12 + (18.02)DL-3-Aminoisobutyric Acid Hydrate extrapure, 98%
CAS:Formula:C4H9NO2·xH2OPurity:min. 98%Color and Shape:White to off-white, Crystalline powderMolecular weight:103.12




