CAS 21416-68-2
:4,4′-(1,2-Dimethyl-1,2-ethanediyl)bis[2,6-piperazinedione]
Description:
4,4′-(1,2-Dimethyl-1,2-ethanediyl)bis[2,6-piperazinedione], with the CAS number 21416-68-2, is a chemical compound characterized by its unique structure, which includes two piperazinedione moieties linked by a dimethyl-ethanediyl group. This compound typically exhibits properties associated with piperazine derivatives, such as potential biological activity and the ability to form hydrogen bonds due to the presence of carbonyl groups in the piperazinedione rings. It may display solubility in polar solvents, reflecting the influence of its functional groups. The compound's structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Additionally, due to its piperazine framework, it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders or other therapeutic areas. However, specific physical properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.
Formula:C12H18N4O4
InChI:InChI=1S/C12H18N4O4/c1-7(15-3-9(17)13-10(18)4-15)8(2)16-5-11(19)14-12(20)6-16/h7-8H,3-6H2,1-2H3,(H,13,17,18)(H,14,19,20)
InChI key:InChIKey=OBYGAPWKTPDTAS-UHFFFAOYSA-N
SMILES:C(C(C)N1CC(=O)NC(=O)C1)(C)N2CC(=O)NC(=O)C2
Synonyms:- 2,6-Piperazinedione, 4,4'-(1,2-dimethyl-1,2-ethanediyl)bis-, (R*,S*)-
- 2,6-Piperazinedione, 4,4'-(1,2-dimethyl-1,2-ethanediyl)bis-, rel-
- 2,6-Piperazinedione, 4,4′-(1,2-dimethyl-1,2-ethanediyl)bis-
- 2,6-Piperazinedione, 4,4′-(1,2-dimethylethylene)di-
- 21416-68-2
- 4,4′-(1,2-Dimethyl-1,2-ethanediyl)bis[2,6-piperazinedione]
- Icrf 193
- Icrf 196
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.

