CAS 21419-25-0
:2-Butanone, 1-amino-3-methyl-, hydrochloride (1:1)
Description:
2-Butanone, 1-amino-3-methyl-, hydrochloride (1:1), also known as 3-methyl-1-amino-2-butanone hydrochloride, is an organic compound characterized by its amine and ketone functional groups. It appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt, which enhances its solubility compared to the free base form. This compound is typically used in pharmaceutical applications and may serve as an intermediate in the synthesis of various bioactive molecules. Its molecular structure includes a butanone backbone with an amino group and a methyl substituent, contributing to its reactivity and potential biological activity. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including acylation and alkylation. Safety data should be consulted for handling and storage, as it may pose health risks if ingested or inhaled. Overall, 2-butanone, 1-amino-3-methyl-, hydrochloride is a significant compound in organic synthesis and medicinal chemistry.
Formula:C5H11NO·ClH
InChI:InChI=1S/C5H11NO.ClH/c1-4(2)5(7)3-6;/h4H,3,6H2,1-2H3;1H
InChI key:InChIKey=INSIHEPGWOLTHR-UHFFFAOYSA-N
SMILES:C(C(C)C)(CN)=O.Cl
Synonyms:- 1-Amino-3-methylbutan-2-one hydrochloride
- 1-Amino-3-methyl-2-butanone monohydrochloride
- 3-Methyl-2-oxobutylamine hydrochloride
- 2-Butanone, 1-amino-3-methyl-, hydrochloride
- 2-Butanone, 1-amino-3-methyl-, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Amino-3-methylbutan-2-one hydrochloride
CAS:Formula:C5H12ClNOPurity:95%Color and Shape:SolidMolecular weight:137.60791-Amino-3-methylbutan-2-one hydrochloride
CAS:Phenyl 1-amino-3-methylbutan-2-one hydrochloride is a phenyl compound that has been shown to be an efficient hypolipidemic agent. It has been shown to reduce lipid levels in the blood and can be used as a drug discovery tool for the creation of new drugs. Phenyl 1-amino-3-methylbutan-2-one hydrochloride mediates advances in drug discovery by promoting the formation of carbon atoms, which are necessary for the synthesis of many drugs.Formula:C5H12ClNOPurity:Min. 95%Molecular weight:137.61 g/mol


