CAS 21419-48-7

6-Bromo-4-quinazolinamine

Description:

6-Bromo-4-quinazolinamine is a chemical compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a bromine atom at the 6-position and an amino group at the 4-position contributes to its unique reactivity and potential biological activity. This compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit anti-cancer or anti-inflammatory effects. It is typically a solid at room temperature and may be soluble in various organic solvents, depending on the specific conditions. The compound's molecular structure allows for various substitution patterns, which can influence its chemical behavior and interactions with biological targets. As with many brominated compounds, it may also exhibit specific environmental and safety considerations, necessitating careful handling and disposal. Overall, 6-Bromo-4-quinazolinamine serves as an important scaffold in drug discovery and development, highlighting the significance of heterocyclic compounds in modern chemistry.

Formula: C₈H₆BrN₃

InChI: InChI=1S/C8H6BrN3/c9-5-1-2-7-6(3-5)8(10)12-4-11-7/h1-4H,(H2,10,11,12)

InChI key: InChIKey=FHCKWLXHKAPOBN-UHFFFAOYSA-N

SMILES: NC=1C2=C(C=CC(Br)=C2)N=CN1

Synonyms:

• 4-Amino-6-bromoquinazoline
• 6-Bromo-4-quinazolinamine
• 6-Bromoquinazolin-4-amine
• Quinazoline, 4-amino-6-bromo-
• 4-Quinazolinamine, 6-bromo-

6-Bromoquinazolin-4-amine

CAS: 21419-48-7

Formula: C₈H₆BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 224.0573

Ref: IN-DA007QKQ

6-Bromoquinazolin-4-amine

CAS: 21419-48-7

6-Bromoquinazolin-4-amine

Purity: 99%

Color and Shape: Solid

Molecular weight: 224.06g/mol

Ref: 54-OR932284

6-Bromoquinazolin-4-amine

CAS: 21419-48-7

Formula: C₈H₆BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 224.061

Ref: 10-F211200

6-Bromoquinazolin-4-amine

CAS: 21419-48-7

6-Bromoquinazolin-4-amine is an alkylamine that is used as a chemical intermediate. It reacts with formamide to produce formamidine, which is a result of the amination of formamide. 6-Bromoquinazolin-4-amine has been shown to react with aromatic amines to produce substituted quinazolines.

Formula: C₈H₆BrN₃

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 224.06 g/mol

Ref: 3D-FB42068