CAS 214193-13-2

(1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxylic acid

Description:

(1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxylic acid is a bicyclic compound characterized by its unique azabicyclo structure, which incorporates a nitrogen atom into a six-membered ring. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The stereochemistry indicated by the (1S,3S,5S) configuration suggests specific spatial arrangements of its substituents, which can influence its biological activity and interactions. The presence of the nitrogen atom in the bicyclic framework may impart basic properties, allowing it to participate in hydrogen bonding and interact with various biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as bicyclic structures often exhibit favorable pharmacokinetic properties. Additionally, its unique structural features may contribute to selectivity and potency in biological systems. Overall, (1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxylic acid represents a fascinating subject for further research in organic and medicinal chemistry.

Formula: C₆H₉NO₂

InChI: InChI=1S/C6H9NO2/c8-6(9)5-2-3-1-4(3)7-5/h3-5,7H,1-2H2,(H,8,9)/t3-,4-,5-/m0/s1

InChI key: InChIKey=XBEMWFUKTKDJKP-YUPRTTJUSA-N

SMILES: C(O)(=O)[C@@H]1C[C@]2([C@](C2)(N1)[H])[H]

Synonyms:

• (1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxylic acid
• 2-Azabicyclo[3.1.0]hexane-3-carboxylic acid, (1S,3S,5S)-

2-Azabicyclo[3.1.0]hexane-3-carboxylic acid, (1S,3S,5S)-

CAS: 214193-13-2

Formula: C₆H₉NO₂

Purity: 97%

Molecular weight: 127.1412

Ref: IN-DA007QKS

(1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxylic Acid

CAS: 214193-13-2

(1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxylic Acid is a crystalline compound in the form of a white solid with a melting point of 210°C and a molecular weight of 164.09 g/mol. It has been used to stabilize the helical conformation of l-proline and proline, which are amino acids that have been shown to inhibit the conformational changes in proteins that may lead to protein misfolding and aggregation. (1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxylic Acid also has structural properties that make it suitable for x-ray crystallography experiments as well as structural studies with dichroism or tetrameric techniques.

Formula: C₆H₉NO₂

Purity: Min. 95%

Molecular weight: 127.14 g/mol

Ref: 3D-PIA19313

(1S,3S,5S)-2-AZABICYCLO[3.1.0]HEXANE-3-CARBOXYLIC ACID

CAS: 214193-13-2

Formula: C₆H₉NO₂

Purity: 97%

Molecular weight: 127.143

Ref: 10-F501868