CAS 214209-94-6

Benzeneethanamine, 3-bromo-N-methyl-, hydrochloride (1:1)

Description:

Benzeneethanamine, 3-bromo-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a bromine substituent on the benzene ring. It is a hydrochloride salt, indicating that it is typically encountered in a solid form, which enhances its solubility in water. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions with other molecules. The presence of the bromine atom may also impart unique reactivity, making it a potential candidate for various synthetic applications in organic chemistry. Additionally, the methyl group attached to the nitrogen atom can affect the steric and electronic properties of the molecule, influencing its biological activity and potential uses in pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₁₂BrN·ClH

InChI: InChI=1S/C9H12BrN.ClH/c1-11-6-5-8-3-2-4-9(10)7-8;/h2-4,7,11H,5-6H2,1H3;1H

InChI key: InChIKey=ZFHNLQQYLVKJBK-UHFFFAOYSA-N

SMILES: C(CNC)C1=CC(Br)=CC=C1.Cl

Synonyms:

• Benzeneethanamine, 3-bromo-N-methyl-, hydrochloride
• [2-(3-Bromophenyl)ethyl](methyl)amine hydrochloride
• Benzeneethanamine, 3-bromo-N-methyl-, hydrochloride (1:1)

[2-(3-Bromophenyl)ethyl](methyl)amine hydrochloride

Controlled Product

CAS: 214209-94-6

Versatile small molecule scaffold

Formula: C₉H₁₃BrClN

Purity: Min. 95%

Molecular weight: 250.56 g/mol

Ref: 3D-PIA20994