CAS 214210-21-6
:3-Cyano-4-fluorobenzeneboronic acid
Description:
3-Cyano-4-fluorobenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, a cyano group, and a fluorine atom attached to a benzene ring. This compound typically exhibits a white to off-white crystalline appearance. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The cyano group contributes to the compound's polarity and can influence its reactivity and solubility in different solvents. The fluorine atom can enhance the compound's electronic properties and stability. Additionally, 3-cyano-4-fluorobenzeneboronic acid may exhibit interesting biological activities, making it a subject of interest in pharmaceutical research. Its unique combination of functional groups allows for diverse applications in the development of new materials and drugs. As with many boronic acids, it is important to handle this compound with care, considering its potential reactivity and the need for proper storage conditions to maintain its stability.
Formula:C7H5BFNO2
InChI:InChI=1/C7H5BFNO2/c9-7-2-1-6(8(11)12)3-5(7)4-10/h1-3,11-12H
SMILES:c1cc(c(cc1B(O)O)C#N)F
Synonyms:- 3-Cyano-4-fluorophenyl)boronic acid
- 3-Cyano-4-fluorophenylboronci acid
- (3-Cyano-4-fluorobenzene)boronic acid
- 3-Cyano-4-fluorophenylboronic acid
- 3-Cyano-4-fluorophneylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Cyano-4-fluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H5BFNO2Purity:97.0 to 113.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:164.933-Cyano-4-fluorobenzeneboronic acid
CAS:Formula:C7H5BFNO2Purity:97%Color and Shape:SolidMolecular weight:164.92953-Cyano-4-fluorobenzeneboronic acid
CAS:3-Cyano-4-fluorobenzeneboronic acidFormula:C7H5BFNO2Purity:97%Color and Shape: white solidMolecular weight:164.93g/mol3-Cyano-4-fluorophenylboronic acid
CAS:Formula:C7H5BFNO2Purity:95%Color and Shape:SolidMolecular weight:164.93




