CymitQuimica logo

CAS 21423-86-9

:

Bi-2,4-cyclopentadien-1-yl

Description:
Bi-2,4-cyclopentadien-1-yl, identified by its CAS number 21423-86-9, is an organometallic compound featuring a bismuth atom coordinated to a cyclopentadienyl ligand. This compound exhibits characteristics typical of organometallics, including potential reactivity due to the presence of the bismuth center, which can participate in various chemical reactions. The cyclopentadienyl ligand contributes to the stability and electronic properties of the compound, often enhancing its reactivity and solubility in organic solvents. Bismuth, being a heavy metal, imparts unique properties such as low toxicity compared to other heavy metals, making compounds like this one of interest in various applications, including catalysis and materials science. The compound's structure allows for potential interactions with other reagents, making it a candidate for further research in synthetic chemistry. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data for comprehensive characterization.
Formula:C10H10
InChI:InChI=1S/C10H10/c1-2-6-9(5-1)10-7-3-4-8-10/h1-10H
InChI key:InChIKey=IZSHZLKNFQAAKX-UHFFFAOYSA-N
SMILES:C1(C=CC=C1)C2C=CC=C2
Synonyms:
  • Fulvalene, dihydro-
  • 2,4-Dicyclopentadien-1-yl
  • Bi-2,4-cyclopentadien-1-yl
  • 5,5′-Bi(cyclopentadiene)
  • 9,10-Dihydrofulvalene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.