CAS 214263-04-4
:1-(2-Chloro-6-fluorophenyl)cyclohexanecarboxylic acid
Description:
1-(2-Chloro-6-fluorophenyl)cyclohexanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclohexane ring substituted with a carboxylic acid group and a phenyl group that has both chlorine and fluorine substituents. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobic characteristics due to the presence of the cyclohexane and phenyl rings. The chlorine and fluorine atoms can influence the compound's reactivity, polarity, and overall biological activity, making it of interest in medicinal chemistry and drug development. The carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can affect solubility and interaction with biological targets. Additionally, the presence of halogens may enhance the compound's stability and lipophilicity, impacting its pharmacokinetic properties. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest in various chemical and pharmaceutical applications.
Formula:C13H14ClFO2
InChI:InChI=1S/C13H14ClFO2/c14-9-5-4-6-10(15)11(9)13(12(16)17)7-2-1-3-8-13/h4-6H,1-3,7-8H2,(H,16,17)
InChI key:InChIKey=YOCRQRLRAGTUCP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CCCCC1)C2=C(Cl)C=CC=C2F
Synonyms:- Cyclohexanecarboxylic acid, 1-(2-chloro-6-fluorophenyl)-
- 1-(2-Chloro-6-fluorophenyl)cyclohexane-1-carboxylic acid
- 1-(2-Chloro-6-fluorophenyl)cyclohexanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.