CAS 214279-40-0
:2-iodo-4-methoxy-1-nitrobenzene
Description:
2-Iodo-4-methoxy-1-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group (-NO2), an iodo group (-I), and a methoxy group (-OCH3) attached to a benzene ring. The presence of these substituents influences its chemical reactivity and physical properties. The iodo group typically enhances the compound's electrophilicity, making it more reactive in nucleophilic substitution reactions. The methoxy group, being an electron-donating group, can stabilize the aromatic ring and influence the orientation of further substitutions. The nitro group is a strong electron-withdrawing group, which can affect the acidity and reactivity of the compound. In terms of solubility, 2-iodo-4-methoxy-1-nitrobenzene is likely to be soluble in organic solvents due to its non-polar aromatic nature, while its polar functional groups may impart some degree of solubility in polar solvents. This compound can be utilized in various synthetic applications, particularly in the field of medicinal chemistry and materials science.
Formula:C7H6INO3
InChI:InChI=1/C7H6INO3/c1-12-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3
SMILES:COc1ccc(c(c1)I)N(=O)=O
Synonyms:- 3-Iodo-4-nitroanisole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Iodo-4-nitroanisole
CAS:3-Iodo-4-nitroanisoleFormula:C7H6INO3Purity:98%Color and Shape: beige/yellow powderMolecular weight:279.03g/mol4-Nitro-3-iodoanisole
CAS:<p>4-Nitro-3-iodoanisole is a bauerine that is used as a ligand in asymmetric catalysis. It is an atropisomeric compound, meaning it can exist in two different forms. The two forms of 4-nitro-3-iodoanisole are identical except for the orientation of the axial ligands on opposite sides of the molecule. The axial ligands on one form are biphenyl and nitrous oxide, while the axial ligands on the other form are nitrous oxide and biphenyl. 4-Nitro-3-iodoanisole has been used to catalyze reactions such as alkylation and coupling reactions with a variety of substrates, including β-carbolines, phenols, and amines.</p>Formula:C7H6INO3Purity:Min. 95%Color and Shape:PowderMolecular weight:279.03 g/mol2-Iodo-4-methoxy-1-nitrobenzene
CAS:Formula:C7H6INO3Purity:95%Color and Shape:SolidMolecular weight:279.033



