CAS 214279-41-1

4-(Bromomethyl)-2-iodo-1-nitrobenzene

Description:

4-(Bromomethyl)-2-iodo-1-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group, a bromomethyl group, and an iodo substituent on a benzene ring. The presence of the nitro group (-NO2) indicates that it is a strong electron-withdrawing group, which can influence the reactivity of the compound in electrophilic aromatic substitution reactions. The bromomethyl group (-CH2Br) serves as a potential site for further chemical modifications, while the iodo group (-I) can enhance the compound's reactivity due to the relatively weak C-I bond. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of halogens and the nitro group, which can be hazardous.

Formula: C₇H₅BrINO₂

InChI: InChI=1S/C7H5BrINO2/c8-4-5-1-2-7(10(11)12)6(9)3-5/h1-3H,4H2

InChI key: InChIKey=SETQWQQIMOUZRS-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(I)C=C(CBr)C=C1

Synonyms:

• Benzene, 4-(Bromomethyl)-2-Iodo-1-Nitro-
• 4-(Bromomethyl)-2-iodo-1-nitrobenzene

4-(Bromomethyl)-2-iodo-1-nitrobenzene

CAS: 214279-41-1

4-(Bromomethyl)-2-iodo-1-nitrobenzene is a fine chemical that can be used as an intermediate for the synthesis of target molecules. It is a versatile building block with many different reactions and applications, such as research chemicals, reaction components, and speciality chemicals. This compound is also a useful building block for the synthesis of complex molecules. It has high quality and can be used as a reagent in lab experiments.

Formula: C₇H₅BrINO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 341.93 g/mol

Ref: 3D-FB67006