CAS 214331-53-0
:1-hydroxy(N-~15~N)urea
Description:
1-Hydroxy(N-~15~N)urea, with the CAS number 214331-53-0, is a nitrogen-containing organic compound that serves as a derivative of urea. This compound features a hydroxyl group (-OH) attached to the carbon atom of the urea structure, which contributes to its unique chemical properties. The presence of the stable isotope nitrogen-15 (N-15) indicates that this compound can be used in isotopic labeling studies, particularly in biological and environmental research, to trace nitrogen pathways and interactions. 1-Hydroxyurea itself is known for its role in various chemical reactions, including its potential use as a reagent in organic synthesis and as a therapeutic agent in certain medical applications. The compound is typically characterized by its solubility in polar solvents, which is influenced by the functional groups present. Additionally, its stability and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 1-hydroxy(N-~15~N)urea is a valuable compound in both research and industrial contexts due to its unique isotopic composition and functional characteristics.
Formula:CH4N15NO2
InChI:InChI=1/CH4N2O2/c2-1(4)3-5/h5H,(H3,2,3,4)/i3+1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Hydroxy Urea-15N
CAS:Controlled ProductApplications Labelled Hydroxyurea. An anti-neoplastic - inhibits ribonucleoside reductase and DNA replication. A potential therapy for sickle cell anemia which involves the nitrosylation of sickle cell hemoglobin. Horseradish peroxidase catalyzes nitric oxide formation from hydroxyurea in the presence of hydrogen peroxide.
References Ratcliffe, W., et al.: Lancet, 339, 164 (1992), Roodman, G., et al.: Cancer, 80, 1557 (1997), Horwitz, M., et al.: J. Clin. Endocrinol. Metab., 2003, 88, 1603 (2003),Formula:CH415NNO2Color and Shape:NeatMolecular weight:77.05

