CAS 214342-63-9

4-bromo-1-methylpyridin-2(1H)-one

Description:

4-Bromo-1-methylpyridin-2(1H)-one, with the CAS number 214342-63-9, is a heterocyclic organic compound featuring a pyridine ring substituted with a bromine atom and a methyl group. This compound is characterized by its aromatic nature, which contributes to its stability and reactivity. The presence of the bromine atom introduces electrophilic characteristics, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methyl group enhances the lipophilicity of the molecule, potentially influencing its solubility in organic solvents. Additionally, the carbonyl group in the pyridinone structure can participate in hydrogen bonding, affecting its interactions in biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 4-bromo-1-methylpyridin-2(1H)-one is a versatile compound with potential applications in various fields of chemistry and pharmacology.

Formula: C₆H₆BrNO

InChI: InChI=1/C6H6BrNO/c1-8-3-2-5(7)4-6(8)9/h2-4H,1H3

SMILES: Cn1ccc(cc1=O)Br

Synonyms:

• 2(1H)-pyridinone, 4-bromo-1-methyl-
• 4-Bromo-1-methylpyridin-2-one
• 4-Bromo-1-Methyl-1,2-Dihydropyridin-2-One

4-Bromo-1-methylpyridin-2(1H)-one

CAS: 214342-63-9

Formula: C₆H₆BrNO

Purity: 96%

Color and Shape: Solid

Molecular weight: 188.0219

Ref: IN-DA00386R

4-Bromo-1-methylpyridin-2(1H)-one

CAS: 214342-63-9

4-Bromo-1-methylpyridin-2(1H)-one

Formula: C₆H₆BrNO

Purity: 97%

Color and Shape: beige solid

Molecular weight: 188.02g/mol

Ref: 54-OR41149

4-Bromo-1-methylpyridin-2(1H)-one

CAS: 214342-63-9

Formula: C₆H₆BrNO

Purity: 96%

Color and Shape: Solid

Molecular weight: 188.024

Ref: 10-F067313