CAS 214351-30-1

(3β,13α,14β,16α)-13-Methyl-26-norurs-7-ene-3,16-diol

Description:

The chemical substance known as "(3β,13α,14β,16α)-13-Methyl-26-norurs-7-ene-3,16-diol," with the CAS number 214351-30-1, is a steroid derivative characterized by its specific structural configuration, which includes multiple hydroxyl (–OH) groups and a unique carbon skeleton typical of steroid compounds. This compound features a norursane framework, indicating a modification of the traditional ursane structure, specifically the absence of a carbon atom at the 26th position. The presence of methyl and hydroxyl groups contributes to its potential biological activity, which may include interactions with steroid receptors or other biological pathways. The stereochemistry, denoted by the specific β and α designations, plays a crucial role in determining the compound's three-dimensional shape and, consequently, its reactivity and interactions with biological systems. Such compounds are often studied for their potential therapeutic applications, including anti-inflammatory or anticancer properties, although specific biological activities would require further investigation through experimental studies.

Formula: C₃₀H₅₀O₂

InChI: InChI=1S/C30H50O2/c1-18-11-14-28(6)24(32)17-30(8)21-9-10-22-26(3,4)23(31)13-15-27(22,5)20(21)12-16-29(30,7)25(28)19(18)2/h9,18-20,22-25,31-32H,10-17H2,1-8H3/t18-,19+,20+,22+,23+,24-,25-,27-,28-,29+,30-/m1/s1

InChI key: InChIKey=RSBGODIKJNCIHA-FZFNGYGSSA-N

SMILES: C[C@]12[C@@](C)(C=3[C@](CC1)([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](O)CC4)[H])[H])C[C@@H](O)[C@]5(C)[C@]2([C@@H](C)[C@H](C)CC5)[H]

Synonyms:

• (3β,13α,14β,16α)-13-Methyl-26-norurs-7-ene-3,16-diol
• 26-Norurs-7-ene-3,16-diol, 13-methyl-, (3β,13α,14β,16α)-
• Bauer-7-ene-3β,16α-diol

26-Norurs-7-ene-3,16-diol, 13-methyl-, (3β,13α,14β,16α)-

CAS: 214351-30-1

Formula: C₃₀H₅₀O₂

Purity: 98.0%

Molecular weight: 442.7168

Ref: IN-DA01PLLZ

16α-Hydroxybauerenol

CAS: 214351-30-1

16alpha-Hydroxybauerenol is a natural product for research related to life sciences. The catalog number is TN2651 and the CAS number is 214351-30-1.

Formula: C₃₀H₅₀O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 442.728

Ref: TM-TN2651

16α-Hydroxybauerenol

Controlled Product

CAS: 214351-30-1

16α-Hydroxybauerenol is a triterpenoid compound, which is a type of naturally occurring chemical substance found within the extensive class of triterpenes. It is primarily derived from botanical sources, most commonly extracted from plant species known for their medicinal properties. The mode of action for 16α-Hydroxybauerenol involves interacting with biochemical pathways, particularly those related to inflammation and cellular proliferation. This compound exhibits potential pharmacological effects by modulating enzyme activity and signaling pathways implicated in the inflammatory response and tumor progression.

Formula: C₃₀H₅₀O₂

Purity: Min. 95%

Molecular weight: 442.7 g/mol

Ref: 3D-PIA35130