CAS 214351-86-7
:tert-butyl{[1-(1-iodopropan-2-yl)-7a-methyloctahydro-1H-inden-4-yl]oxy}dimethylsilane
Description:
Tert-butyl{[1-(1-iodopropan-2-yl)-7a-methyloctahydro-1H-inden-4-yl]oxy}dimethylsilane, with the CAS number 214351-86-7, is a complex organosilicon compound characterized by the presence of a tert-butyl group, a silane moiety, and a substituted indene structure. This compound features a siloxane bond, which imparts unique properties such as increased thermal stability and hydrophobicity. The presence of the iodine atom in the propyl group suggests potential reactivity, making it useful in various synthetic applications, including nucleophilic substitution reactions. The bulky tert-butyl group enhances steric hindrance, which can influence the compound's reactivity and solubility in organic solvents. Additionally, the octahydroindene structure contributes to its potential as a building block in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Overall, this compound exemplifies the intricate interplay between organic and inorganic chemistry, showcasing the versatility of silane derivatives in chemical synthesis and material science.
Formula:C19H37IOSi
InChI:InChI=1/C19H37IOSi/c1-14(13-20)15-10-11-16-17(9-8-12-19(15,16)5)21-22(6,7)18(2,3)4/h14-17H,8-13H2,1-7H3
SMILES:CC(CI)C1CCC2C(CCCC12C)O[Si](C)(C)C(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
