CAS 214353-17-0
:1,1-Ethanediol, 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-, hydrochloride (1:1)
Description:
1,1-Ethanediol, 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its specific functional groups and structural features. It contains an ethanediol backbone, which is a diol (two hydroxyl groups) that contributes to its solubility in polar solvents. The presence of a 2-amino-5-chlorophenyl group indicates that it has an amino functional group and a chlorine substituent on the aromatic ring, which can influence its reactivity and biological activity. The trifluoromethyl group (–CF3) enhances the compound's lipophilicity and can affect its pharmacokinetic properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with halogenated compounds.
Formula:C8H7ClF3NO2·ClH
InChI:InChI=1S/C8H7ClF3NO2.ClH/c9-4-1-2-6(13)5(3-4)7(14,15)8(10,11)12;/h1-3,14-15H,13H2;1H
InChI key:InChIKey=SYLRXHNMJUPJDK-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(O)(O)C1=C(N)C=CC(Cl)=C1.Cl
Synonyms:- 1,1-Ethanediol, 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-, hydrochloride
- 1,1-Ethanediol, 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-, hydrochloride (1:1)
- 1-(2-Amino-5-Chlorophenyl)-2,2,2-Trifluoroethane-1,1-Diol
- 4-Chloro-2-(2,2,2-Trifluoro-1,1-Dihydroxyethyl)Anilinium Chloride
- 4-Chloro-2-trifluoroacetoaniline hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoroethane-1,1-diol hydrochloride
CAS:Formula:C8H8Cl2F3NO2Molecular weight:278.0558
