CAS 21438-60-8
:his-ser
Description:
The chemical substance known as "his-ser," with the CAS number 21438-60-8, is a dipeptide composed of the amino acids histidine and serine. It is characterized by its role in various biological processes, particularly in protein synthesis and metabolism. The presence of histidine, an essential amino acid, contributes to its function in enzyme activity and as a precursor for histamine, while serine plays a crucial role in the synthesis of proteins and other biomolecules. This dipeptide can exhibit properties such as solubility in water due to its polar amino acid components, and it may participate in various biochemical pathways. Additionally, it may have implications in research related to neurobiology and metabolic processes. The stability and reactivity of his-ser can be influenced by factors such as pH and temperature, which are important considerations in experimental settings. Overall, his-ser serves as a valuable compound in the study of biochemistry and molecular biology.
Formula:C9H14N4O4
InChI:InChI=1/C9H14N4O4/c10-6(1-5-2-11-4-12-5)8(15)13-7(3-14)9(16)17/h2,4,6-7,14H,1,3,10H2,(H,11,12)(H,13,15)(H,16,17)
SMILES:C(c1cnc[nH]1)C(C(=NC(CO)C(=O)O)O)N
Synonyms:- H-His-Ser-OH
- Histidylserine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-His-Ser-OH
CAS:The 1:1 complex of histidylserine with Co(II)(Cys-Gly) was shown to cleave DNA by hydrolysis at physiological pH. Cleavage has also been observed employing the analogous Co complex with His-Phe.Formula:C9H14N4O4Purity:99%Color and Shape:Beige PowderMolecular weight:242.24H-His-Ser-OH
CAS:<p>H-His-Ser-OH is a type of histidine with a hydroxyl group at the 3' position. It is an amino acid found in proteins and natural products. H-His-Ser-OH has been shown to be a synthetic substrate for the production of monoclonal antibodies, which are used as therapeutic agents in cancer treatment. The metabolic disorders that affect H-His-Ser-OH include human serum albumin and hemoglobinuria. This amino acid also plays a role in cervical cancer, neutral pH, and amide bonds. H-His-Ser-OH is also known to be a growth factor and has been linked to autoimmune diseases, site specific phosphorylation, and peptide hormones.br>br>br></p>Formula:C9H14N4O4Purity:Min. 95%Molecular weight:242.23 g/mol


