CymitQuimica logo

CAS 214470-66-3

:

7-(3-chloropropoxy)-4-hydroxy-6-methoxyquinoline-3-carbonitrile

Description:
7-(3-Chloropropoxy)-4-hydroxy-6-methoxyquinoline-3-carbonitrile is a chemical compound characterized by its complex structure, which includes a quinoline core, a hydroxyl group, a methoxy group, and a carbonitrile functional group. The presence of the 3-chloropropoxy substituent contributes to its unique properties, potentially influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The carbonitrile group may also impart specific chemical reactivity, allowing for further derivatization or functionalization. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature. Safety and handling precautions should be observed due to the presence of chlorine and other functional groups that may pose hazards. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C14H13ClN2O3
InChI:InChI=1/C14H13ClN2O3/c1-19-12-5-10-11(6-13(12)20-4-2-3-15)17-8-9(7-16)14(10)18/h5-6,8H,2-4H2,1H3,(H,17,18)
SMILES:COc1cc2c(cc1OCCCCl)[nH]cc(C#N)c2=O
Synonyms:
  • 7-(3-Chlorpropoxy)-4-hydroxy-6-methoxychinolin-3-carbonitril
  • 3-Quinolinecarbonitrile, 7-(3-chloropropoxy)-4-hydroxy-6-Methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.