CymitQuimica logo

CAS 214476-08-1

:

7-Ethoxy-4-hydroxy-6-nitro-3-quinolinecarbonitrile

Description:
7-Ethoxy-4-hydroxy-6-nitro-3-quinolinecarbonitrile is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features an ethoxy group, a hydroxy group, and a nitro group, contributing to its unique chemical properties and potential biological activity. The presence of the carbonitrile functional group enhances its reactivity and may influence its solubility and interaction with other molecules. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents, due to the biological significance of quinoline derivatives. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its physical properties, such as melting point, boiling point, and solubility, would be important for practical applications and further research. Safety and handling precautions should be observed, as with any chemical substance, particularly those with nitro and cyano groups, which can pose health risks.
Formula:C12H9N3O4
InChI:InChI=1S/C12H9N3O4/c1-2-19-11-4-9-8(3-10(11)15(17)18)12(16)7(5-13)6-14-9/h3-4,6H,2H2,1H3,(H,14,16)
InChI key:InChIKey=YWXULSPHZDNVAN-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(OCC)C(N(=O)=O)=C2)N=CC1C#N
Synonyms:
  • 3-Quinolinecarbonitrile, 7-ethoxy-4-hydroxy-6-nitro-
  • 4-Hydroxy-6-nitro-7-ethoxyquinoline-3-carbonitrile
  • 7-Ethoxy-4-Hydroxy-6-Nitroquinoline-3-Carbonitrile
  • 7-Ethoxy-4-hydroxy-6-nitro-3-quinolinecarbonitrile
  • 7-Ethoxy-4-hydroxy-6-nitrochinolin-3-carbonitril
Found 3 products.