CymitQuimica logo

CAS 2145-31-5

:

3-(trifluoromethyl)phenoxyacetonitrile

Description:
3-(Trifluoromethyl)phenoxyacetonitrile, with the CAS number 2145-31-5, is an organic compound characterized by its unique structure, which includes a phenoxy group and a trifluoromethyl substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its relatively low solubility in water but is soluble in organic solvents such as acetone and dichloromethane. The presence of the trifluoromethyl group imparts distinctive electronic properties, enhancing its reactivity and making it useful in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the acetonitrile functional group contributes to its utility in organic synthesis. Due to its chemical structure, it may exhibit specific biological activities, although detailed toxicity and environmental impact assessments are necessary for safe handling and usage. Overall, 3-(trifluoromethyl)phenoxyacetonitrile is a compound of interest in both industrial and research settings.
Formula:C8H7FO3
InChI:InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3
InChI key:UGZFDPFADQHEMW-UHFFFAOYSA-N
SMILES:COC(=O)c1ccc(c(c1)O)F
Synonyms:
  • 2-[3-(Trifluoromethyl)phenoxy]acetonitrile
  • Methyl 4-Fluoro-3-Hydroxybenzoate
Found 3 products.